CID 9833950
2-(oxiran-2-yl)pyridine
Structural Information
- Molecular Formula
- C7H7NO
- SMILES
- C1C(O1)C2=CC=CC=N2
- InChI
- InChI=1S/C7H7NO/c1-2-4-8-6(3-1)7-5-9-7/h1-4,7H,5H2
- InChIKey
- DVZRYTWXFWRYPT-UHFFFAOYSA-N
- Compound name
- 2-(oxiran-2-yl)pyridine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 122.06004 | 123.8 |
| [M+Na]+ | 144.04198 | 134.2 |
| [M-H]- | 120.04549 | 131.0 |
| [M+NH4]+ | 139.08659 | 138.8 |
| [M+K]+ | 160.01592 | 133.5 |
| [M+H-H2O]+ | 104.05002 | 116.5 |
| [M+HCOO]- | 166.05097 | 147.6 |
| [M+CH3COO]- | 180.06662 | 138.4 |
| [M+Na-2H]- | 142.02743 | 134.2 |
| [M]+ | 121.05222 | 126.5 |
| [M]- | 121.05331 | 126.5 |