CID 94815
10-undecenamide
Structural Information
- Molecular Formula
- C11H21NO
- SMILES
- C=CCCCCCCCCC(=O)N
- InChI
- InChI=1S/C11H21NO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2,(H2,12,13)
- InChIKey
- YRIDFQASBDRMBJ-UHFFFAOYSA-N
- Compound name
- undec-10-enamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 184.16959 | 147.0 |
| [M+Na]+ | 206.15153 | 151.6 |
| [M-H]- | 182.15503 | 145.8 |
| [M+NH4]+ | 201.19613 | 166.3 |
| [M+K]+ | 222.12547 | 149.3 |
| [M+H-H2O]+ | 166.15957 | 141.3 |
| [M+HCOO]- | 228.16051 | 169.1 |
| [M+CH3COO]- | 242.17616 | 187.4 |
| [M+Na-2H]- | 204.13698 | 149.2 |
| [M]+ | 183.16176 | 147.7 |
| [M]- | 183.16286 | 147.7 |