CID 9245
Bicyclo[4.1.0]heptane
Structural Information
- Molecular Formula
- C7H12
- SMILES
- C1CCC2CC2C1
- InChI
- InChI=1S/C7H12/c1-2-4-7-5-6(7)3-1/h6-7H,1-5H2
- InChIKey
- WPHGSKGZRAQSGP-UHFFFAOYSA-N
- Compound name
- bicyclo[4.1.0]heptane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 97.101176 | 119.2 |
| [M+Na]+ | 119.08312 | 127.4 |
| [M-H]- | 95.086624 | 124.3 |
| [M+NH4]+ | 114.12772 | 138.6 |
| [M+K]+ | 135.05706 | 125.9 |
| [M+H-H2O]+ | 79.091160 | 113.7 |
| [M+HCOO]- | 141.09210 | 140.2 |
| [M+CH3COO]- | 155.10775 | 170.6 |
| [M+Na-2H]- | 117.06857 | 127.6 |
| [M]+ | 96.093351 | 117.9 |
| [M]- | 96.094449 | 117.9 |