CID 89270
1,4-cyclohexanedicarboxamide
Structural Information
- Molecular Formula
- C8H14N2O2
- SMILES
- C1CC(CCC1C(=O)N)C(=O)N
- InChI
- InChI=1S/C8H14N2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h5-6H,1-4H2,(H2,9,11)(H2,10,12)
- InChIKey
- ZWUNKULTLYLLTH-UHFFFAOYSA-N
- Compound name
- cyclohexane-1,4-dicarboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 171.11281 | 137.5 |
| [M+Na]+ | 193.09475 | 141.4 |
| [M-H]- | 169.09825 | 139.4 |
| [M+NH4]+ | 188.13935 | 156.3 |
| [M+K]+ | 209.06869 | 140.5 |
| [M+H-H2O]+ | 153.10279 | 131.5 |
| [M+HCOO]- | 215.10373 | 157.6 |
| [M+CH3COO]- | 229.11938 | 183.3 |
| [M+Na-2H]- | 191.08020 | 138.4 |
| [M]+ | 170.10498 | 129.7 |
| [M]- | 170.10608 | 129.7 |