CID 817731
            
    2,4-dimethoxypyridine
Structural Information
- Molecular Formula
- C7H9NO2
- SMILES
- COC1=CC(=NC=C1)OC
- InChI
- InChI=1S/C7H9NO2/c1-9-6-3-4-8-7(5-6)10-2/h3-5H,1-2H3
- InChIKey
- CSJLJSGWKXPGRN-UHFFFAOYSA-N
- Compound name
- 2,4-dimethoxypyridine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) | 
|---|---|---|
| [M+H]+ | 140.07060 | 124.8 | 
| [M+Na]+ | 162.05254 | 134.0 | 
| [M-H]- | 138.05604 | 127.6 | 
| [M+NH4]+ | 157.09714 | 145.5 | 
| [M+K]+ | 178.02648 | 133.6 | 
| [M+H-H2O]+ | 122.06058 | 118.6 | 
| [M+HCOO]- | 184.06152 | 149.3 | 
| [M+CH3COO]- | 198.07717 | 173.1 | 
| [M+Na-2H]- | 160.03799 | 133.6 | 
| [M]+ | 139.06277 | 127.8 | 
| [M]- | 139.06387 | 127.8 |