CID 8037
110-18-9
Structural Information
- Molecular Formula
- C6H16N2
- SMILES
- CN(C)CCN(C)C
- InChI
- InChI=1S/C6H16N2/c1-7(2)5-6-8(3)4/h5-6H2,1-4H3
- InChIKey
- KWYHDKDOAIKMQN-UHFFFAOYSA-N
- Compound name
- N,N,N',N'-tetramethylethane-1,2-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 117.13863 | 127.1 |
| [M+Na]+ | 139.12057 | 132.9 |
| [M-H]- | 115.12407 | 130.3 |
| [M+NH4]+ | 134.16517 | 150.6 |
| [M+K]+ | 155.09451 | 135.5 |
| [M+H-H2O]+ | 99.128610 | 121.5 |
| [M+HCOO]- | 161.12955 | 153.9 |
| [M+CH3COO]- | 175.14520 | 184.0 |
| [M+Na-2H]- | 137.10602 | 133.1 |
| [M]+ | 116.13080 | 129.3 |
| [M]- | 116.13190 | 129.3 |