CID 80167
Diethyl pentylmalonate
Structural Information
- Molecular Formula
- C12H22O4
- SMILES
- CCCCCC(C(=O)OCC)C(=O)OCC
- InChI
- InChI=1S/C12H22O4/c1-4-7-8-9-10(11(13)15-5-2)12(14)16-6-3/h10H,4-9H2,1-3H3
- InChIKey
- OQFYXOBMUBGANU-UHFFFAOYSA-N
- Compound name
- diethyl 2-pentylpropanedioate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 231.15909 | 156.3 |
| [M+Na]+ | 253.14103 | 161.1 |
| [M-H]- | 229.14453 | 155.8 |
| [M+NH4]+ | 248.18563 | 174.4 |
| [M+K]+ | 269.11497 | 161.4 |
| [M+H-H2O]+ | 213.14907 | 150.7 |
| [M+HCOO]- | 275.15001 | 176.6 |
| [M+CH3COO]- | 289.16566 | 192.5 |
| [M+Na-2H]- | 251.12648 | 156.6 |
| [M]+ | 230.15126 | 162.3 |
| [M]- | 230.15236 | 162.3 |