CID 79248
2-n-butyrylthiophene
Structural Information
- Molecular Formula
- C8H10OS
- SMILES
- CCCC(=O)C1=CC=CS1
- InChI
- InChI=1S/C8H10OS/c1-2-4-7(9)8-5-3-6-10-8/h3,5-6H,2,4H2,1H3
- InChIKey
- YXHIINNJOGKPLF-UHFFFAOYSA-N
- Compound name
- 1-thiophen-2-ylbutan-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 155.05252 | 132.3 |
| [M+Na]+ | 177.03446 | 140.6 |
| [M-H]- | 153.03796 | 136.4 |
| [M+NH4]+ | 172.07906 | 155.8 |
| [M+K]+ | 193.00840 | 138.8 |
| [M+H-H2O]+ | 137.04250 | 127.3 |
| [M+HCOO]- | 199.04344 | 152.1 |
| [M+CH3COO]- | 213.05909 | 174.4 |
| [M+Na-2H]- | 175.01991 | 134.0 |
| [M]+ | 154.04469 | 135.0 |
| [M]- | 154.04579 | 135.0 |