CID 7823
1,2,6-hexanetriol
Structural Information
- Molecular Formula
- C6H14O3
- SMILES
- C(CCO)CC(CO)O
- InChI
- InChI=1S/C6H14O3/c7-4-2-1-3-6(9)5-8/h6-9H,1-5H2
- InChIKey
- ZWVMLYRJXORSEP-UHFFFAOYSA-N
- Compound name
- hexane-1,2,6-triol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 135.10158 | 130.5 |
| [M+Na]+ | 157.08352 | 136.1 |
| [M-H]- | 133.08702 | 126.5 |
| [M+NH4]+ | 152.12812 | 150.3 |
| [M+K]+ | 173.05746 | 135.0 |
| [M+H-H2O]+ | 117.09156 | 126.3 |
| [M+HCOO]- | 179.09250 | 149.4 |
| [M+CH3COO]- | 193.10815 | 166.1 |
| [M+Na-2H]- | 155.06897 | 134.6 |
| [M]+ | 134.09375 | 129.7 |
| [M]- | 134.09485 | 129.7 |