CID 78039
4336-19-0
Structural Information
- Molecular Formula
- C10H14O4
- SMILES
- COC(=O)C1=C(CCCC1)C(=O)OC
- InChI
- InChI=1S/C10H14O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H2,1-2H3
- InChIKey
- APGUUZNLMFETAH-UHFFFAOYSA-N
- Compound name
- dimethyl cyclohexene-1,2-dicarboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 199.09648 | 141.5 |
| [M+Na]+ | 221.07842 | 147.4 |
| [M-H]- | 197.08192 | 144.7 |
| [M+NH4]+ | 216.12302 | 160.7 |
| [M+K]+ | 237.05236 | 147.6 |
| [M+H-H2O]+ | 181.08646 | 135.7 |
| [M+HCOO]- | 243.08740 | 162.2 |
| [M+CH3COO]- | 257.10305 | 183.0 |
| [M+Na-2H]- | 219.06387 | 144.2 |
| [M]+ | 198.08865 | 142.3 |
| [M]- | 198.08975 | 142.3 |