CID 746555
4-(piperidine-1-sulfonyl)benzoic acid
Structural Information
- Molecular Formula
- C12H15NO4S
- SMILES
- C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C(=O)O
- InChI
- InChI=1S/C12H15NO4S/c14-12(15)10-4-6-11(7-5-10)18(16,17)13-8-2-1-3-9-13/h4-7H,1-3,8-9H2,(H,14,15)
- InChIKey
- UQNINMUUJYRESG-UHFFFAOYSA-N
- Compound name
- 4-piperidin-1-ylsulfonylbenzoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 270.07945 | 157.7 |
| [M+Na]+ | 292.06139 | 163.2 |
| [M-H]- | 268.06489 | 161.1 |
| [M+NH4]+ | 287.10599 | 171.9 |
| [M+K]+ | 308.03533 | 159.9 |
| [M+H-H2O]+ | 252.06943 | 150.7 |
| [M+HCOO]- | 314.07037 | 169.4 |
| [M+CH3COO]- | 328.08602 | 189.2 |
| [M+Na-2H]- | 290.04684 | 160.0 |
| [M]+ | 269.07162 | 155.7 |
| [M]- | 269.07272 | 155.7 |