CID 737445
2-amino-5-bromonicotinic acid
Structural Information
- Molecular Formula
- C6H5BrN2O2
- SMILES
- C1=C(C=NC(=C1C(=O)O)N)Br
- InChI
- InChI=1S/C6H5BrN2O2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H2,8,9)(H,10,11)
- InChIKey
- IEPDTLRHISNBLB-UHFFFAOYSA-N
- Compound name
- 2-amino-5-bromopyridine-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 216.96073 | 133.6 |
| [M+Na]+ | 238.94267 | 145.6 |
| [M-H]- | 214.94617 | 137.5 |
| [M+NH4]+ | 233.98727 | 153.4 |
| [M+K]+ | 254.91661 | 134.4 |
| [M+H-H2O]+ | 198.95071 | 133.0 |
| [M+HCOO]- | 260.95165 | 153.8 |
| [M+CH3COO]- | 274.96730 | 183.4 |
| [M+Na-2H]- | 236.92812 | 140.5 |
| [M]+ | 215.95290 | 150.2 |
| [M]- | 215.95400 | 150.2 |