CID 73739
2-ethylisonicotinonitrile
Structural Information
- Molecular Formula
- C8H8N2
- SMILES
- CCC1=NC=CC(=C1)C#N
- InChI
- InChI=1S/C8H8N2/c1-2-8-5-7(6-9)3-4-10-8/h3-5H,2H2,1H3
- InChIKey
- WERAOGVQORFBMU-UHFFFAOYSA-N
- Compound name
- 2-ethylpyridine-4-carbonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 133.07602 | 124.9 |
| [M+Na]+ | 155.05796 | 135.4 |
| [M-H]- | 131.06146 | 126.9 |
| [M+NH4]+ | 150.10256 | 143.6 |
| [M+K]+ | 171.03190 | 132.8 |
| [M+H-H2O]+ | 115.06600 | 112.2 |
| [M+HCOO]- | 177.06694 | 144.8 |
| [M+CH3COO]- | 191.08259 | 186.4 |
| [M+Na-2H]- | 153.04341 | 132.6 |
| [M]+ | 132.06819 | 120.2 |
| [M]- | 132.06929 | 120.2 |