CID 737135
3-amino-1-benzylthiourea
Structural Information
- Molecular Formula
- C8H11N3S
- SMILES
- C1=CC=C(C=C1)CNC(=S)NN
- InChI
- InChI=1S/C8H11N3S/c9-11-8(12)10-6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H2,10,11,12)
- InChIKey
- ZTRUHAVBRPABTK-UHFFFAOYSA-N
- Compound name
- 1-amino-3-benzylthiourea
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 182.07465 | 136.4 |
| [M+Na]+ | 204.05659 | 142.0 |
| [M-H]- | 180.06009 | 139.4 |
| [M+NH4]+ | 199.10119 | 155.5 |
| [M+K]+ | 220.03053 | 138.3 |
| [M+H-H2O]+ | 164.06463 | 129.6 |
| [M+HCOO]- | 226.06557 | 157.3 |
| [M+CH3COO]- | 240.08122 | 184.9 |
| [M+Na-2H]- | 202.04204 | 140.8 |
| [M]+ | 181.06682 | 133.2 |
| [M]- | 181.06792 | 133.2 |