CID 72789
1048649-86-0
Structural Information
- Molecular Formula
- C7H8N4O
- SMILES
- C1=CC(=CC=C1N=NC(=N)N)O
- InChI
- InChI=1S/C7H8N4O/c8-7(9)11-10-5-1-3-6(12)4-2-5/h1-4,12H,(H3,8,9)
- InChIKey
- GDFOKRDMGTXXCS-UHFFFAOYSA-N
- Compound name
- 1-(4-hydroxyphenyl)iminoguanidine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 165.07709 | 131.3 |
| [M+Na]+ | 187.05903 | 137.9 |
| [M-H]- | 163.06253 | 136.3 |
| [M+NH4]+ | 182.10363 | 151.0 |
| [M+K]+ | 203.03297 | 136.7 |
| [M+H-H2O]+ | 147.06707 | 124.2 |
| [M+HCOO]- | 209.06801 | 161.0 |
| [M+CH3COO]- | 223.08366 | 188.2 |
| [M+Na-2H]- | 185.04448 | 139.1 |
| [M]+ | 164.06926 | 127.9 |
| [M]- | 164.07036 | 127.9 |