CID 7140352
3-methyl-1h-pyrrole-2-carboxylic acid
Structural Information
- Molecular Formula
- C6H7NO2
- SMILES
- CC1=C(NC=C1)C(=O)O
- InChI
- InChI=1S/C6H7NO2/c1-4-2-3-7-5(4)6(8)9/h2-3,7H,1H3,(H,8,9)
- InChIKey
- YIVHOQIKHMTVRG-UHFFFAOYSA-N
- Compound name
- 3-methyl-1H-pyrrole-2-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 126.05495 | 123.2 |
| [M+Na]+ | 148.03689 | 131.8 |
| [M-H]- | 124.04040 | 123.3 |
| [M+NH4]+ | 143.08150 | 144.6 |
| [M+K]+ | 164.01083 | 129.9 |
| [M+H-H2O]+ | 108.04494 | 118.0 |
| [M+HCOO]- | 170.04588 | 144.8 |
| [M+CH3COO]- | 184.06153 | 164.8 |
| [M+Na-2H]- | 146.02234 | 127.7 |
| [M]+ | 125.04713 | 121.3 |
| [M]- | 125.04822 | 121.3 |