CID 71021
4-sulfophenylmethallyl ether
Structural Information
- Molecular Formula
- C10H12O4S
- SMILES
- CC(=C)COC1=CC=C(C=C1)S(=O)(=O)O
- InChI
- InChI=1S/C10H12O4S/c1-8(2)7-14-9-3-5-10(6-4-9)15(11,12)13/h3-6H,1,7H2,2H3,(H,11,12,13)
- InChIKey
- BMINOSJSODYULL-UHFFFAOYSA-N
- Compound name
- 4-(2-methylprop-2-enoxy)benzenesulfonic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 229.05290 | 146.6 |
| [M+Na]+ | 251.03484 | 154.6 |
| [M-H]- | 227.03834 | 149.2 |
| [M+NH4]+ | 246.07944 | 164.4 |
| [M+K]+ | 267.00878 | 151.6 |
| [M+H-H2O]+ | 211.04288 | 141.2 |
| [M+HCOO]- | 273.04382 | 162.9 |
| [M+CH3COO]- | 287.05947 | 183.5 |
| [M+Na-2H]- | 249.02029 | 149.7 |
| [M]+ | 228.04507 | 150.0 |
| [M]- | 228.04617 | 150.0 |