CID 69141
4-hydroxyquinoline
Structural Information
- Molecular Formula
- C9H7NO
- SMILES
- C1=CC=C2C(=C1)C(=O)C=CN2
- InChI
- InChI=1S/C9H7NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-6H,(H,10,11)
- InChIKey
- PMZDQRJGMBOQBF-UHFFFAOYSA-N
- Compound name
- 1H-quinolin-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 146.06004 | 124.9 |
| [M+Na]+ | 168.04198 | 134.7 |
| [M-H]- | 144.04548 | 127.2 |
| [M+NH4]+ | 163.08658 | 145.5 |
| [M+K]+ | 184.01592 | 130.8 |
| [M+H-H2O]+ | 128.05002 | 118.9 |
| [M+HCOO]- | 190.05096 | 147.1 |
| [M+CH3COO]- | 204.06661 | 139.0 |
| [M+Na-2H]- | 166.02743 | 135.4 |
| [M]+ | 145.05221 | 123.4 |
| [M]- | 145.05331 | 123.4 |