CID 678476
Methyl 2-cyano-3-(4-methoxyphenyl)acrylate
Structural Information
- Molecular Formula
- C12H11NO3
- SMILES
- COC1=CC=C(C=C1)/C=C(\C#N)/C(=O)OC
- InChI
- InChI=1S/C12H11NO3/c1-15-11-5-3-9(4-6-11)7-10(8-13)12(14)16-2/h3-7H,1-2H3/b10-7+
- InChIKey
- MCFCPVVFVXSZSK-JXMROGBWSA-N
- Compound name
- methyl (E)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 218.08118 | 149.0 |
| [M+Na]+ | 240.06312 | 158.2 |
| [M-H]- | 216.06662 | 152.2 |
| [M+NH4]+ | 235.10772 | 165.6 |
| [M+K]+ | 256.03706 | 155.7 |
| [M+H-H2O]+ | 200.07116 | 136.3 |
| [M+HCOO]- | 262.07210 | 168.1 |
| [M+CH3COO]- | 276.08775 | 199.0 |
| [M+Na-2H]- | 238.04857 | 152.1 |
| [M]+ | 217.07335 | 146.4 |
| [M]- | 217.07445 | 146.4 |