CID 67069
N-methylanthranilic acid
Structural Information
- Molecular Formula
- C8H9NO2
- SMILES
- CNC1=CC=CC=C1C(=O)O
- InChI
- InChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11)
- InChIKey
- WVMBPWMAQDVZCM-UHFFFAOYSA-N
- Compound name
- 2-(methylamino)benzoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 152.07060 | 129.0 |
| [M+Na]+ | 174.05254 | 136.5 |
| [M-H]- | 150.05604 | 131.7 |
| [M+NH4]+ | 169.09714 | 149.3 |
| [M+K]+ | 190.02648 | 134.7 |
| [M+H-H2O]+ | 134.06058 | 123.5 |
| [M+HCOO]- | 196.06152 | 153.1 |
| [M+CH3COO]- | 210.07717 | 175.6 |
| [M+Na-2H]- | 172.03799 | 135.6 |
| [M]+ | 151.06277 | 127.8 |
| [M]- | 151.06387 | 127.8 |