CID 66015
3-methylbenzylamine
Structural Information
- Molecular Formula
- C8H11N
- SMILES
- CC1=CC(=CC=C1)CN
- InChI
- InChI=1S/C8H11N/c1-7-3-2-4-8(5-7)6-9/h2-5H,6,9H2,1H3
- InChIKey
- RGXUCUWVGKLACF-UHFFFAOYSA-N
- Compound name
- (3-methylphenyl)methanamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 122.09643 | 123.3 |
| [M+Na]+ | 144.07837 | 131.3 |
| [M-H]- | 120.08187 | 126.9 |
| [M+NH4]+ | 139.12297 | 145.5 |
| [M+K]+ | 160.05231 | 129.3 |
| [M+H-H2O]+ | 104.08641 | 118.0 |
| [M+HCOO]- | 166.08735 | 148.6 |
| [M+CH3COO]- | 180.10300 | 173.5 |
| [M+Na-2H]- | 142.06382 | 130.7 |
| [M]+ | 121.08860 | 121.5 |
| [M]- | 121.08970 | 121.5 |