CID 6482358
4-decanoyl-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione
Structural Information
- Molecular Formula
- C20H32O4
- SMILES
- CCCCCCCCCC(=O)C1=C(C(C(=O)C(C1=O)(C)C)(C)C)O
- InChI
- InChI=1S/C20H32O4/c1-6-7-8-9-10-11-12-13-14(21)15-16(22)19(2,3)18(24)20(4,5)17(15)23/h22H,6-13H2,1-5H3
- InChIKey
- TWALKIRRGNQGET-UHFFFAOYSA-N
- Compound name
- 4-decanoyl-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 337.23735 | 175.3 |
| [M+Na]+ | 359.21929 | 182.5 |
| [M-H]- | 335.22279 | 177.3 |
| [M+NH4]+ | 354.26389 | 193.4 |
| [M+K]+ | 375.19323 | 179.4 |
| [M+H-H2O]+ | 319.22733 | 171.6 |
| [M+HCOO]- | 381.22827 | 192.2 |
| [M+CH3COO]- | 395.24392 | 214.3 |
| [M+Na-2H]- | 357.20474 | 174.5 |
| [M]+ | 336.22952 | 180.5 |
| [M]- | 336.23062 | 180.5 |