CID 6154037
Cintriamide
Structural Information
- Molecular Formula
- C12H15NO4
- SMILES
- COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)N
- InChI
- InChI=1S/C12H15NO4/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H2,13,14)/b5-4+
- InChIKey
- LRLKZVMLJBNNPE-SNAWJCMRSA-N
- Compound name
- (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 238.10739 | 151.1 |
| [M+Na]+ | 260.08933 | 159.3 |
| [M-H]- | 236.09283 | 154.8 |
| [M+NH4]+ | 255.13393 | 168.8 |
| [M+K]+ | 276.06327 | 157.8 |
| [M+H-H2O]+ | 220.09737 | 144.7 |
| [M+HCOO]- | 282.09831 | 175.4 |
| [M+CH3COO]- | 296.11396 | 194.9 |
| [M+Na-2H]- | 258.07478 | 153.7 |
| [M]+ | 237.09956 | 155.2 |
| [M]- | 237.10066 | 155.2 |