CID 605713
Methyl 5-bromothiophene-2-carboxylate
Structural Information
- Molecular Formula
- C6H5BrO2S
- SMILES
- COC(=O)C1=CC=C(S1)Br
- InChI
- InChI=1S/C6H5BrO2S/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3
- InChIKey
- QLWUHAQCKDHUNL-UHFFFAOYSA-N
- Compound name
- methyl 5-bromothiophene-2-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 220.92664 | 131.8 |
| [M+Na]+ | 242.90858 | 145.5 |
| [M-H]- | 218.91208 | 139.3 |
| [M+NH4]+ | 237.95318 | 156.6 |
| [M+K]+ | 258.88252 | 135.3 |
| [M+H-H2O]+ | 202.91662 | 133.1 |
| [M+HCOO]- | 264.91756 | 150.4 |
| [M+CH3COO]- | 278.93321 | 181.3 |
| [M+Na-2H]- | 240.89403 | 136.0 |
| [M]+ | 219.91881 | 154.0 |
| [M]- | 219.91991 | 154.0 |