CID 601008
Ethyl 2-aminobenzo[d]thiazole-6-carboxylate
Structural Information
- Molecular Formula
- C10H10N2O2S
- SMILES
- CCOC(=O)C1=CC2=C(C=C1)N=C(S2)N
- InChI
- InChI=1S/C10H10N2O2S/c1-2-14-9(13)6-3-4-7-8(5-6)15-10(11)12-7/h3-5H,2H2,1H3,(H2,11,12)
- InChIKey
- VYJSGJXWKSDUSG-UHFFFAOYSA-N
- Compound name
- ethyl 2-amino-1,3-benzothiazole-6-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 223.05358 | 145.3 |
| [M+Na]+ | 245.03552 | 156.0 |
| [M-H]- | 221.03902 | 149.3 |
| [M+NH4]+ | 240.08012 | 165.8 |
| [M+K]+ | 261.00946 | 152.7 |
| [M+H-H2O]+ | 205.04356 | 139.4 |
| [M+HCOO]- | 267.04450 | 165.3 |
| [M+CH3COO]- | 281.06015 | 187.7 |
| [M+Na-2H]- | 243.02097 | 148.6 |
| [M]+ | 222.04575 | 150.1 |
| [M]- | 222.04685 | 150.1 |