CID 59541
(phenylthio)acetic acid
Structural Information
- Molecular Formula
- C8H8O2S
- SMILES
- C1=CC=C(C=C1)SCC(=O)O
- InChI
- InChI=1S/C8H8O2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)
- InChIKey
- MOTOSAGBNXXRRE-UHFFFAOYSA-N
- Compound name
- 2-phenylsulfanylacetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 169.03178 | 132.4 |
| [M+Na]+ | 191.01372 | 139.9 |
| [M-H]- | 167.01722 | 134.9 |
| [M+NH4]+ | 186.05832 | 152.6 |
| [M+K]+ | 206.98766 | 137.2 |
| [M+H-H2O]+ | 151.02176 | 127.0 |
| [M+HCOO]- | 213.02270 | 150.1 |
| [M+CH3COO]- | 227.03835 | 173.5 |
| [M+Na-2H]- | 188.99917 | 136.2 |
| [M]+ | 168.02395 | 133.8 |
| [M]- | 168.02505 | 133.8 |