CID 592968
[4-(methylsulfanyl)phenyl]methanol
Structural Information
- Molecular Formula
- C8H10OS
- SMILES
- CSC1=CC=C(C=C1)CO
- InChI
- InChI=1S/C8H10OS/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3
- InChIKey
- MTXQKSQYMREAGJ-UHFFFAOYSA-N
- Compound name
- (4-methylsulfanylphenyl)methanol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 155.05252 | 128.7 |
| [M+Na]+ | 177.03446 | 137.2 |
| [M-H]- | 153.03796 | 131.6 |
| [M+NH4]+ | 172.07906 | 150.0 |
| [M+K]+ | 193.00840 | 134.2 |
| [M+H-H2O]+ | 137.04250 | 123.7 |
| [M+HCOO]- | 199.04344 | 147.0 |
| [M+CH3COO]- | 213.05909 | 172.7 |
| [M+Na-2H]- | 175.01991 | 132.9 |
| [M]+ | 154.04469 | 130.4 |
| [M]- | 154.04579 | 130.4 |