CID 589850
2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
Structural Information
- Molecular Formula
- C10H9NO3
- SMILES
- C1C(C2=CC=CC=C2NC1=O)C(=O)O
- InChI
- InChI=1S/C10H9NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-4,7H,5H2,(H,11,12)(H,13,14)
- InChIKey
- UFTLCDHPTBFVHE-UHFFFAOYSA-N
- Compound name
- 2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 192.06552 | 137.9 |
| [M+Na]+ | 214.04746 | 145.4 |
| [M-H]- | 190.05096 | 138.3 |
| [M+NH4]+ | 209.09206 | 155.7 |
| [M+K]+ | 230.02140 | 141.9 |
| [M+H-H2O]+ | 174.05550 | 131.9 |
| [M+HCOO]- | 236.05644 | 154.8 |
| [M+CH3COO]- | 250.07209 | 177.7 |
| [M+Na-2H]- | 212.03291 | 143.4 |
| [M]+ | 191.05769 | 134.0 |
| [M]- | 191.05879 | 134.0 |