CID 588555
2,3-dimethyl-4-nitroindole
Structural Information
- Molecular Formula
- C10H10N2O2
- SMILES
- CC1=C(NC2=C1C(=CC=C2)[N+](=O)[O-])C
- InChI
- InChI=1S/C10H10N2O2/c1-6-7(2)11-8-4-3-5-9(10(6)8)12(13)14/h3-5,11H,1-2H3
- InChIKey
- PQVLMUJSDORONP-UHFFFAOYSA-N
- Compound name
- 2,3-dimethyl-4-nitro-1H-indole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 191.08151 | 137.1 |
| [M+Na]+ | 213.06345 | 147.3 |
| [M-H]- | 189.06695 | 140.3 |
| [M+NH4]+ | 208.10805 | 157.5 |
| [M+K]+ | 229.03739 | 139.7 |
| [M+H-H2O]+ | 173.07149 | 136.1 |
| [M+HCOO]- | 235.07243 | 161.8 |
| [M+CH3COO]- | 249.08808 | 176.1 |
| [M+Na-2H]- | 211.04890 | 145.3 |
| [M]+ | 190.07368 | 136.9 |
| [M]- | 190.07478 | 137.0 |