CID 587481
6-amino-1-phenalenone
Structural Information
- Molecular Formula
- C13H9NO
- SMILES
- C1=CC2=C(C=CC3=C2C(=C1)C(=O)C=C3)N
- InChI
- InChI=1S/C13H9NO/c14-11-6-4-8-5-7-12(15)10-3-1-2-9(11)13(8)10/h1-7H,14H2
- InChIKey
- LNWQVXDBQBAGHD-UHFFFAOYSA-N
- Compound name
- 6-aminophenalen-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 196.07570 | 138.8 |
| [M+Na]+ | 218.05764 | 148.5 |
| [M-H]- | 194.06114 | 143.7 |
| [M+NH4]+ | 213.10224 | 160.4 |
| [M+K]+ | 234.03158 | 144.0 |
| [M+H-H2O]+ | 178.06568 | 132.6 |
| [M+HCOO]- | 240.06662 | 161.2 |
| [M+CH3COO]- | 254.08227 | 152.6 |
| [M+Na-2H]- | 216.04309 | 148.0 |
| [M]+ | 195.06787 | 138.3 |
| [M]- | 195.06897 | 138.3 |