CID 580610
55750-48-6
Structural Information
- Molecular Formula
- C6H5NO4
- SMILES
- COC(=O)N1C(=O)C=CC1=O
- InChI
- InChI=1S/C6H5NO4/c1-11-6(10)7-4(8)2-3-5(7)9/h2-3H,1H3
- InChIKey
- LLAZQXZGAVBLRX-UHFFFAOYSA-N
- Compound name
- methyl 2,5-dioxopyrrole-1-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 156.02913 | 125.6 |
| [M+Na]+ | 178.01107 | 135.6 |
| [M-H]- | 154.01457 | 128.7 |
| [M+NH4]+ | 173.05567 | 147.3 |
| [M+K]+ | 193.98501 | 135.5 |
| [M+H-H2O]+ | 138.01911 | 120.3 |
| [M+HCOO]- | 200.02005 | 149.6 |
| [M+CH3COO]- | 214.03570 | 172.6 |
| [M+Na-2H]- | 175.99652 | 129.7 |
| [M]+ | 155.02130 | 127.8 |
| [M]- | 155.02240 | 127.8 |