CID 574769
4-methoxy-2,5-dihydro-1h-pyrrol-2-one
Structural Information
- Molecular Formula
- C5H7NO2
- SMILES
- COC1=CC(=O)NC1
- InChI
- InChI=1S/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7)
- InChIKey
- TXKQBYYDTLOLHA-UHFFFAOYSA-N
- Compound name
- 3-methoxy-1,2-dihydropyrrol-5-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 114.05495 | 119.3 |
| [M+Na]+ | 136.03689 | 128.0 |
| [M-H]- | 112.04040 | 120.5 |
| [M+NH4]+ | 131.08150 | 141.8 |
| [M+K]+ | 152.01083 | 127.0 |
| [M+H-H2O]+ | 96.044936 | 114.0 |
| [M+HCOO]- | 158.04588 | 142.2 |
| [M+CH3COO]- | 172.06153 | 163.9 |
| [M+Na-2H]- | 134.02234 | 125.1 |
| [M]+ | 113.04713 | 118.1 |
| [M]- | 113.04822 | 118.1 |