CID 57474247
2c-cn hcl
Structural Information
- Molecular Formula
- C11H14N2O2
- SMILES
- COC1=CC(=C(C=C1CCN)OC)C#N
- InChI
- InChI=1S/C11H14N2O2/c1-14-10-6-9(7-13)11(15-2)5-8(10)3-4-12/h5-6H,3-4,12H2,1-2H3
- InChIKey
- OGWCKYKYGQORLF-UHFFFAOYSA-N
- Compound name
- 4-(2-aminoethyl)-2,5-dimethoxybenzonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 207.11281 | 144.7 |
| [M+Na]+ | 229.09475 | 154.9 |
| [M-H]- | 205.09825 | 148.0 |
| [M+NH4]+ | 224.13935 | 161.9 |
| [M+K]+ | 245.06869 | 152.6 |
| [M+H-H2O]+ | 189.10279 | 132.3 |
| [M+HCOO]- | 251.10373 | 165.7 |
| [M+CH3COO]- | 265.11938 | 201.7 |
| [M+Na-2H]- | 227.08020 | 148.7 |
| [M]+ | 206.10498 | 142.2 |
| [M]- | 206.10608 | 142.2 |