CID 54423513
Hex-1-en-1-yl hexanoate
Structural Information
- Molecular Formula
- C12H22O2
- SMILES
- CCCCCC(=O)OC=CCCCC
- InChI
- InChI=1S/C12H22O2/c1-3-5-7-9-11-14-12(13)10-8-6-4-2/h9,11H,3-8,10H2,1-2H3
- InChIKey
- WCLULVFNXDFNHL-UHFFFAOYSA-N
- Compound name
- hex-1-enyl hexanoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 199.16927 | 150.2 |
| [M+Na]+ | 221.15121 | 155.5 |
| [M-H]- | 197.15471 | 149.6 |
| [M+NH4]+ | 216.19581 | 169.8 |
| [M+K]+ | 237.12515 | 153.9 |
| [M+H-H2O]+ | 181.15925 | 144.8 |
| [M+HCOO]- | 243.16019 | 172.0 |
| [M+CH3COO]- | 257.17584 | 187.0 |
| [M+Na-2H]- | 219.13666 | 152.9 |
| [M]+ | 198.16144 | 154.5 |
| [M]- | 198.16254 | 154.5 |