CID 537768
6-ethyl-2-methyloctane
Structural Information
- Molecular Formula
- C11H24
- SMILES
- CCC(CC)CCCC(C)C
- InChI
- InChI=1S/C11H24/c1-5-11(6-2)9-7-8-10(3)4/h10-11H,5-9H2,1-4H3
- InChIKey
- AZXGABNJUBNOHW-UHFFFAOYSA-N
- Compound name
- 6-ethyl-2-methyloctane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 157.19508 | 142.4 |
| [M+Na]+ | 179.17702 | 147.1 |
| [M-H]- | 155.18052 | 142.1 |
| [M+NH4]+ | 174.22162 | 163.7 |
| [M+K]+ | 195.15096 | 146.6 |
| [M+H-H2O]+ | 139.18506 | 137.5 |
| [M+HCOO]- | 201.18600 | 162.6 |
| [M+CH3COO]- | 215.20165 | 184.2 |
| [M+Na-2H]- | 177.16247 | 144.4 |
| [M]+ | 156.18725 | 144.3 |
| [M]- | 156.18835 | 144.3 |