CID 53481368
5(6)-epoxy prostaglandin e1
Structural Information
- Molecular Formula
- C20H32O6
- SMILES
- CCCCC[C@@H](/C=C/[C@@H]1[C@H](CC(=O)[C@H]1CC2C(O2)CCCC(=O)O)O)O
- InChI
- InChI=1S/C20H32O6/c1-2-3-4-6-13(21)9-10-14-15(17(23)12-16(14)22)11-19-18(26-19)7-5-8-20(24)25/h9-10,13-16,18-19,21-22H,2-8,11-12H2,1H3,(H,24,25)/b10-9+/t13-,14-,15-,16-,18?,19?/m0/s1
- InChIKey
- CBOBGOJUDRNUHE-HHECASJMSA-N
- Compound name
- 4-[3-[[(1S,2S,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]methyl]oxiran-2-yl]butanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 369.22716 | 183.9 |
| [M+Na]+ | 391.20910 | 188.7 |
| [M-H]- | 367.21260 | 186.9 |
| [M+NH4]+ | 386.25370 | 190.5 |
| [M+K]+ | 407.18304 | 183.6 |
| [M+H-H2O]+ | 351.21714 | 178.2 |
| [M+HCOO]- | 413.21808 | 197.0 |
| [M+CH3COO]- | 427.23373 | 214.3 |
| [M+Na-2H]- | 389.19455 | 178.8 |
| [M]+ | 368.21933 | 189.1 |
| [M]- | 368.22043 | 189.1 |