CID 5324110
3-phenyl-1h-pyrrole
Structural Information
- Molecular Formula
- C10H9N
- SMILES
- C1=CC=C(C=C1)C2=CNC=C2
- InChI
- InChI=1S/C10H9N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8,11H
- InChIKey
- LJDRAKFYYGCAQC-UHFFFAOYSA-N
- Compound name
- 3-phenyl-1H-pyrrole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 144.08078 | 127.6 |
| [M+Na]+ | 166.06272 | 135.6 |
| [M-H]- | 142.06622 | 131.8 |
| [M+NH4]+ | 161.10732 | 148.6 |
| [M+K]+ | 182.03666 | 131.9 |
| [M+H-H2O]+ | 126.07076 | 120.9 |
| [M+HCOO]- | 188.07170 | 151.4 |
| [M+CH3COO]- | 202.08735 | 141.5 |
| [M+Na-2H]- | 164.04817 | 134.9 |
| [M]+ | 143.07295 | 124.7 |
| [M]- | 143.07405 | 124.7 |