CID 5321884
82373-94-2
Structural Information
- Molecular Formula
- C20H22O9
- SMILES
- C1=CC(=CC=C1/C=C/C2=C(C(=CC(=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O
- InChI
- InChI=1S/C20H22O9/c21-9-15-16(25)17(26)18(27)20(28-15)29-19-11(7-13(23)8-14(19)24)4-1-10-2-5-12(22)6-3-10/h1-8,15-18,20-27H,9H2/b4-1+/t15-,16-,17+,18-,20+/m1/s1
- InChIKey
- JAYVHSBYKLLDJC-DSNJPTTOSA-N
- Compound name
- (2S,3R,4S,5S,6R)-2-[2,4-dihydroxy-6-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 407.13365 | 193.3 |
| [M+Na]+ | 429.11559 | 198.2 |
| [M-H]- | 405.11909 | 195.1 |
| [M+NH4]+ | 424.16019 | 197.9 |
| [M+K]+ | 445.08953 | 195.1 |
| [M+H-H2O]+ | 389.12363 | 184.9 |
| [M+HCOO]- | 451.12457 | 202.5 |
| [M+CH3COO]- | 465.14022 | 212.1 |
| [M+Na-2H]- | 427.10104 | 190.5 |
| [M]+ | 406.12582 | 191.3 |
| [M]- | 406.12692 | 191.3 |