CID 5321398
Sophoricoside
Structural Information
- Molecular Formula
- C21H20O10
- SMILES
- C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
- InChI
- InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-3-1-9(2-4-11)12-8-29-14-6-10(23)5-13(24)16(14)17(12)25/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1
- InChIKey
- ISQRJFLLIDGZEP-CMWLGVBASA-N
- Compound name
- 5,7-dihydroxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 433.11293 | 197.8 |
| [M+Na]+ | 455.09487 | 204.5 |
| [M-H]- | 431.09837 | 203.2 |
| [M+NH4]+ | 450.13947 | 201.6 |
| [M+K]+ | 471.06881 | 204.0 |
| [M+H-H2O]+ | 415.10291 | 188.5 |
| [M+HCOO]- | 477.10385 | 206.9 |
| [M+CH3COO]- | 491.11950 | 220.8 |
| [M+Na-2H]- | 453.08032 | 198.3 |
| [M]+ | 432.10510 | 199.5 |
| [M]- | 432.10620 | 199.5 |