CID 5297195
8-nitroquinolin-5-amine
Structural Information
- Molecular Formula
- C9H7N3O2
- SMILES
- C1=CC2=C(C=CC(=C2N=C1)[N+](=O)[O-])N
- InChI
- InChI=1S/C9H7N3O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H,10H2
- InChIKey
- HUJXJGQTEDKYER-UHFFFAOYSA-N
- Compound name
- 8-nitroquinolin-5-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 190.06111 | 133.9 |
| [M+Na]+ | 212.04305 | 142.2 |
| [M-H]- | 188.04655 | 137.3 |
| [M+NH4]+ | 207.08765 | 152.0 |
| [M+K]+ | 228.01699 | 135.3 |
| [M+H-H2O]+ | 172.05109 | 131.6 |
| [M+HCOO]- | 234.05203 | 158.6 |
| [M+CH3COO]- | 248.06768 | 179.0 |
| [M+Na-2H]- | 210.02850 | 144.7 |
| [M]+ | 189.05328 | 131.1 |
| [M]- | 189.05438 | 131.1 |