CID 5281715
3-hydroxy-5-methoxy-6-prenylstilbene-2-carboxylic acid
Structural Information
- Molecular Formula
- C21H22O4
- SMILES
- CC(=CCC1=C(C=C(C(=C1/C=C/C2=CC=CC=C2)C(=O)O)O)OC)C
- InChI
- InChI=1S/C21H22O4/c1-14(2)9-11-16-17(12-10-15-7-5-4-6-8-15)20(21(23)24)18(22)13-19(16)25-3/h4-10,12-13,22H,11H2,1-3H3,(H,23,24)/b12-10+
- InChIKey
- DFMCTODOEICLEB-ZRDIBKRKSA-N
- Compound name
- 6-hydroxy-4-methoxy-3-(3-methylbut-2-enyl)-2-[(E)-2-phenylethenyl]benzoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 339.15908 | 180.8 |
| [M+Na]+ | 361.14102 | 187.3 |
| [M-H]- | 337.14452 | 184.9 |
| [M+NH4]+ | 356.18562 | 193.2 |
| [M+K]+ | 377.11496 | 182.0 |
| [M+H-H2O]+ | 321.14906 | 173.2 |
| [M+HCOO]- | 383.15000 | 199.2 |
| [M+CH3COO]- | 397.16565 | 209.2 |
| [M+Na-2H]- | 359.12647 | 179.1 |
| [M]+ | 338.15125 | 182.5 |
| [M]- | 338.15235 | 182.5 |