CID 5280729
(1s,2s)-3-oxo-2-(2'z-pentenyl)-cyclopentaneoctanoic acid
Structural Information
- Molecular Formula
- C18H30O3
- SMILES
- CC/C=C\C[C@H]1[C@H](CCC1=O)CCCCCCCC(=O)O
- InChI
- InChI=1S/C18H30O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,15-16H,2,4-6,8-14H2,1H3,(H,20,21)/b7-3-/t15-,16-/m0/s1
- InChIKey
- BZXZFDKIRZBJEP-JMTMCXQRSA-N
- Compound name
- 8-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 295.22676 | 176.8 |
| [M+Na]+ | 317.20870 | 180.2 |
| [M-H]- | 293.21220 | 177.3 |
| [M+NH4]+ | 312.25330 | 193.4 |
| [M+K]+ | 333.18264 | 175.9 |
| [M+H-H2O]+ | 277.21674 | 170.6 |
| [M+HCOO]- | 339.21768 | 194.8 |
| [M+CH3COO]- | 353.23333 | 202.6 |
| [M+Na-2H]- | 315.19415 | 173.0 |
| [M]+ | 294.21893 | 178.2 |
| [M]- | 294.22003 | 178.2 |