CID 5274873
2-pyridinecarboxamide,3-hydroxy-n-phenyl-
Structural Information
- Molecular Formula
- C12H10N2O2
- SMILES
- C1=CC=C(C=C1)NC(=O)C2=C(C=CC=N2)O
- InChI
- InChI=1S/C12H10N2O2/c15-10-7-4-8-13-11(10)12(16)14-9-5-2-1-3-6-9/h1-8,15H,(H,14,16)
- InChIKey
- YOSUDLTVIDUOSG-UHFFFAOYSA-N
- Compound name
- 3-hydroxy-N-phenylpyridine-2-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 215.08151 | 145.1 |
| [M+Na]+ | 237.06345 | 152.2 |
| [M-H]- | 213.06695 | 149.4 |
| [M+NH4]+ | 232.10805 | 161.0 |
| [M+K]+ | 253.03739 | 148.6 |
| [M+H-H2O]+ | 197.07149 | 137.1 |
| [M+HCOO]- | 259.07243 | 168.0 |
| [M+CH3COO]- | 273.08808 | 185.6 |
| [M+Na-2H]- | 235.04890 | 152.4 |
| [M]+ | 214.07368 | 143.2 |
| [M]- | 214.07478 | 143.2 |