CID 5163733
Piperidine-2,3-dione
Structural Information
- Molecular Formula
- C5H7NO2
- SMILES
- C1CC(=O)C(=O)NC1
- InChI
- InChI=1S/C5H7NO2/c7-4-2-1-3-6-5(4)8/h1-3H2,(H,6,8)
- InChIKey
- CNMOHEDUVVUVPP-UHFFFAOYSA-N
- Compound name
- piperidine-2,3-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 114.05495 | 119.9 |
| [M+Na]+ | 136.03689 | 126.9 |
| [M-H]- | 112.04040 | 120.5 |
| [M+NH4]+ | 131.08150 | 140.4 |
| [M+K]+ | 152.01083 | 125.6 |
| [M+H-H2O]+ | 96.044936 | 114.4 |
| [M+HCOO]- | 158.04588 | 139.4 |
| [M+CH3COO]- | 172.06153 | 163.6 |
| [M+Na-2H]- | 134.02234 | 126.1 |
| [M]+ | 113.04713 | 114.5 |
| [M]- | 113.04822 | 114.5 |