CID 469912
4014-00-0
Structural Information
- Molecular Formula
- C9H22N2
- SMILES
- CCC(C)NCCNC(C)C
- InChI
- InChI=1S/C9H22N2/c1-5-9(4)11-7-6-10-8(2)3/h8-11H,5-7H2,1-4H3
- InChIKey
- VELKVXYYFGKWRG-UHFFFAOYSA-N
- Compound name
- N'-butan-2-yl-N-propan-2-ylethane-1,2-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 159.18558 | 142.3 |
| [M+Na]+ | 181.16752 | 146.0 |
| [M-H]- | 157.17102 | 142.1 |
| [M+NH4]+ | 176.21212 | 162.7 |
| [M+K]+ | 197.14146 | 145.9 |
| [M+H-H2O]+ | 141.17556 | 136.5 |
| [M+HCOO]- | 203.17650 | 165.1 |
| [M+CH3COO]- | 217.19215 | 187.7 |
| [M+Na-2H]- | 179.15297 | 145.5 |
| [M]+ | 158.17775 | 141.7 |
| [M]- | 158.17885 | 141.7 |