CID 44257255
7,2'-dihydroxy-6,4'-dimethoxyisoflavone
Structural Information
- Molecular Formula
- C17H14O6
- SMILES
- COC1=CC(=C(C=C1)C2=COC3=CC(=C(C=C3C2=O)OC)O)O
- InChI
- InChI=1S/C17H14O6/c1-21-9-3-4-10(13(18)5-9)12-8-23-15-7-14(19)16(22-2)6-11(15)17(12)20/h3-8,18-19H,1-2H3
- InChIKey
- RHNVSRHYVGNPEO-UHFFFAOYSA-N
- Compound name
- 7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 315.08632 | 167.8 |
| [M+Na]+ | 337.06826 | 178.7 |
| [M-H]- | 313.07176 | 175.1 |
| [M+NH4]+ | 332.11286 | 181.3 |
| [M+K]+ | 353.04220 | 176.6 |
| [M+H-H2O]+ | 297.07630 | 160.0 |
| [M+HCOO]- | 359.07724 | 188.1 |
| [M+CH3COO]- | 373.09289 | 203.6 |
| [M+Na-2H]- | 335.05371 | 173.2 |
| [M]+ | 314.07849 | 174.0 |
| [M]- | 314.07959 | 174.0 |