CID 42607626
4,2',6'-trihydroxy-3,4'-dimethoxychalcone
Structural Information
- Molecular Formula
- C17H16O6
- SMILES
- COC1=CC(=C(C(=C1)O)C(=O)/C=C/C2=CC(=C(C=C2)O)OC)O
- InChI
- InChI=1S/C17H16O6/c1-22-11-8-14(20)17(15(21)9-11)13(19)6-4-10-3-5-12(18)16(7-10)23-2/h3-9,18,20-21H,1-2H3/b6-4+
- InChIKey
- IBIYLFIHGWIFSB-GQCTYLIASA-N
- Compound name
- (E)-1-(2,6-dihydroxy-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 317.10198 | 169.7 |
| [M+Na]+ | 339.08392 | 177.8 |
| [M-H]- | 315.08742 | 173.3 |
| [M+NH4]+ | 334.12852 | 182.4 |
| [M+K]+ | 355.05786 | 174.2 |
| [M+H-H2O]+ | 299.09196 | 162.4 |
| [M+HCOO]- | 361.09290 | 189.0 |
| [M+CH3COO]- | 375.10855 | 201.3 |
| [M+Na-2H]- | 337.06937 | 170.2 |
| [M]+ | 316.09415 | 172.8 |
| [M]- | 316.09525 | 172.8 |