CID 3866
2-phenylglycine
Structural Information
- Molecular Formula
- C8H9NO2
- SMILES
- C1=CC=C(C=C1)C(C(=O)O)N
- InChI
- InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)
- InChIKey
- ZGUNAGUHMKGQNY-UHFFFAOYSA-N
- Compound name
- 2-amino-2-phenylacetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 152.07060 | 130.5 |
| [M+Na]+ | 174.05254 | 136.7 |
| [M-H]- | 150.05604 | 132.3 |
| [M+NH4]+ | 169.09714 | 150.0 |
| [M+K]+ | 190.02648 | 135.1 |
| [M+H-H2O]+ | 134.06058 | 124.8 |
| [M+HCOO]- | 196.06152 | 152.9 |
| [M+CH3COO]- | 210.07717 | 174.8 |
| [M+Na-2H]- | 172.03799 | 135.4 |
| [M]+ | 151.06277 | 127.2 |
| [M]- | 151.06387 | 127.2 |