CID 384428
5-methyl-4-oxa-8-thia-6-azatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),5-trien-3-one
Structural Information
- Molecular Formula
- C11H11NO2S
- SMILES
- CC1=NC2=C(C3=C(S2)CCCC3)C(=O)O1
- InChI
- InChI=1S/C11H11NO2S/c1-6-12-10-9(11(13)14-6)7-4-2-3-5-8(7)15-10/h2-5H2,1H3
- InChIKey
- MSLWJDFZJOUINW-UHFFFAOYSA-N
- Compound name
- 2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]oxazin-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 222.05834 | 142.2 |
| [M+Na]+ | 244.04028 | 154.2 |
| [M-H]- | 220.04378 | 148.1 |
| [M+NH4]+ | 239.08488 | 163.3 |
| [M+K]+ | 260.01422 | 151.5 |
| [M+H-H2O]+ | 204.04832 | 137.1 |
| [M+HCOO]- | 266.04926 | 158.9 |
| [M+CH3COO]- | 280.06491 | 156.6 |
| [M+Na-2H]- | 242.02573 | 147.7 |
| [M]+ | 221.05051 | 146.9 |
| [M]- | 221.05161 | 146.9 |