CID 350657
2-sulfanylbenzamide
Structural Information
- Molecular Formula
- C7H7NOS
- SMILES
- C1=CC=C(C(=C1)C(=O)N)S
- InChI
- InChI=1S/C7H7NOS/c8-7(9)5-3-1-2-4-6(5)10/h1-4,10H,(H2,8,9)
- InChIKey
- RIDMSOMIFFTEJO-UHFFFAOYSA-N
- Compound name
- 2-sulfanylbenzamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 154.03212 | 128.1 |
| [M+Na]+ | 176.01406 | 136.6 |
| [M-H]- | 152.01756 | 131.9 |
| [M+NH4]+ | 171.05866 | 149.3 |
| [M+K]+ | 191.98800 | 133.9 |
| [M+H-H2O]+ | 136.02210 | 122.6 |
| [M+HCOO]- | 198.02304 | 147.6 |
| [M+CH3COO]- | 212.03869 | 176.3 |
| [M+Na-2H]- | 173.99951 | 131.4 |
| [M]+ | 153.02429 | 128.1 |
| [M]- | 153.02539 | 128.1 |